CAS 340306-87-8 is the registry number for SIRT5 inhibitor 2. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 50 mg, 25 mg, 100 mg, 5 mg.
(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 340306-87-8) is a chemical compound with the molecular formula C18H12Cl2N2O3S and a molecular weight of 407.3 g/mol. IUPAC name: (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: NASLGRREAVKNNT-FMIVXFBMSA-N.
| Molecular formula | C18H12Cl2N2O3S |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | NASLGRREAVKNNT-FMIVXFBMSA-N |
| SMILES | C=CCN1C(=O)/C(=C/C2=CC=C(O2)C3=C(C(=CC=C3)Cl)Cl)/C(=O)NC1=S |
Computed by PubChem (NCBI)