CAS 34047-66-0 is the registry number for 2-Acetamido-2-deoxy-D-glucuronic Acid. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(2S,3S,4R,5R)-5-acetamido-2,3,4-trihydroxy-6-oxohexanoic acid (CAS 34047-66-0) is a chemical compound with the molecular formula C8H13NO7 and a molecular weight of 235.19 g/mol. IUPAC name: (2S,3S,4R,5R)-5-acetamido-2,3,4-trihydroxy-6-oxohexanoic acid. InChIKey: MQWZJOSNNICZJE-VZFHVOOUSA-N.
| Molecular formula | C8H13NO7 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | (2S,3S,4R,5R)-5-acetamido-2,3,4-trihydroxy-6-oxohexanoic acid |
| InChIKey | MQWZJOSNNICZJE-VZFHVOOUSA-N |
| SMILES | CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](C(=O)O)O)O)O |
Computed by PubChem (NCBI)