CAS 3406-71-1 appears in our catalog under these names: 2-(4-Nitrobenzenesulfinyl)acetic acid, 2-((4-Nitrophenyl)sulfinyl)acetic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
2-(4-nitrophenyl)sulfinylacetic acid (CAS 3406-71-1) is a chemical compound with the molecular formula C8H7NO5S and a molecular weight of 229.21 g/mol. IUPAC name: 2-(4-nitrophenyl)sulfinylacetic acid. InChIKey: QPJSCXVOHBMWNG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5S |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 2-(4-nitrophenyl)sulfinylacetic acid |
| InChIKey | QPJSCXVOHBMWNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)CC(=O)O |
Computed by PubChem (NCBI)