Products 34074-60-7
CAS 34074-60-7 is the registry number for Bis(4-(2-(4-hydroxyphenyl)propan-2-yl)phenyl) carbonate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Carbonic acid;bis(4-[2-(4-hydroxyphenyl)propan-2-yl]phenol) (CAS 34074-60-7) is a chemical compound with the molecular formula C31H34O7 and a molecular weight of 518.6 g/mol. IUPAC name: carbonic acid;bis(4-[2-(4-hydroxyphenyl)propan-2-yl]phenol). InChIKey: MHDSQTACKJLLKC-UHFFFAOYSA-N.
| Molecular formula | C31H34O7 |
|---|---|
| Molecular weight | 518.6 g/mol |
| IUPAC name | carbonic acid;bis(4-[2-(4-hydroxyphenyl)propan-2-yl]phenol) |
| InChIKey | MHDSQTACKJLLKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=O)(O)O |
Computed by PubChem (NCBI)