CAS 340804-57-1 is the registry number for 5-HT1A antagonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(4aR,10aR)-9-methoxy-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]-trimethylsilane (CAS 340804-57-1) is a chemical compound with the molecular formula C18H29NOSi and a molecular weight of 303.5 g/mol. IUPAC name: [(4aR,10aR)-9-methoxy-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]-trimethylsilane. InChIKey: SZLRWHGBKFVGQZ-CZUORRHYSA-N.
| Molecular formula | C18H29NOSi |
|---|---|
| Molecular weight | 303.5 g/mol |
| IUPAC name | [(4aR,10aR)-9-methoxy-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]-trimethylsilane |
| InChIKey | SZLRWHGBKFVGQZ-CZUORRHYSA-N |
| SMILES | CN1CCC[C@H]2[C@H]1CC3=C(C=CC(=C3C2)[Si](C)(C)C)OC |
Computed by PubChem (NCBI)