CAS 34083-55-1 appears in our catalog under these names: (R)-Methyl 2-phenylpropanoate, 97%, (R)–Methyl 2–phenylpropanoate, Methyl (2R)-2-phenylpropanoate, (R)-Methyl 2-phenylpropanoate, 99%(GC-MS),RG. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
Methyl (2R)-2-phenylpropanoate (CAS 34083-55-1) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: methyl (2R)-2-phenylpropanoate. InChIKey: DZIQUZJSNSZOCH-MRVPVSSYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | methyl (2R)-2-phenylpropanoate |
| InChIKey | DZIQUZJSNSZOCH-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)