CAS 341-02-6 appears in our catalog under these names: Triphenylcarbenium tetrafluoroborate, 98%, Triphenylmethylium Tetrafluoroborate, Triphenylmethylium Tetrafluoroborate, Triphenylcarbenium tetrafluoroborate, 97% , Triphenylmethylium Tetrafluoroborate, >98.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 2,5g, 100g, 10g, 50g, 250g.
Diphenylmethylbenzene tetrafluoroborate (CAS 341-02-6) is a chemical compound with the molecular formula C19H15BF4 and a molecular weight of 330.1 g/mol. IUPAC name: diphenylmethylbenzene tetrafluoroborate. InChIKey: VQXBOEYKSVVPSP-UHFFFAOYSA-N.
| Molecular formula | C19H15BF4 |
|---|---|
| Molecular weight | 330.1 g/mol |
| IUPAC name | diphenylmethylbenzene tetrafluoroborate |
| InChIKey | VQXBOEYKSVVPSP-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[C+](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)