CAS 3410-77-3 appears in our catalog under these names: Tetraisocyanatosilane, 97%, Tetraisocyanatosilane, Tetraisocyanatosilane, >97.0%(N), Tetraisocyanatosilane, 97%+,RG, 97%+,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
Tetraisocyanatosilane (CAS 3410-77-3) is a chemical compound with the molecular formula C4N4O4Si and a molecular weight of 196.15 g/mol. IUPAC name: tetraisocyanatosilane. InChIKey: UVVUGWBBCDFNSD-UHFFFAOYSA-N.
| Molecular formula | C4N4O4Si |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | tetraisocyanatosilane |
| InChIKey | UVVUGWBBCDFNSD-UHFFFAOYSA-N |
| SMILES | C(=N[Si](N=C=O)(N=C=O)N=C=O)=O |
Computed by PubChem (NCBI)