CAS 341006-18-6 appears in our catalog under these names: 5-(Methoxymethoxy)-2-methylphenylboronic acid, 95%, (5-(Methoxymethoxy)-2-methylphenyl)boronic acid, 95+%, 5-(Methoxymethoxy)-2-methylphenylboronic acid, 95%, 95%, 5-(Methoxymethoxy)-2-methylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
[5-(methoxymethoxy)-2-methylphenyl]boronic acid (CAS 341006-18-6) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: [5-(methoxymethoxy)-2-methylphenyl]boronic acid. InChIKey: KXBXFELZYMVBDD-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | [5-(methoxymethoxy)-2-methylphenyl]boronic acid |
| InChIKey | KXBXFELZYMVBDD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCOC)C)(O)O |
Computed by PubChem (NCBI)