Products 341023-38-9
CAS 341023-38-9 is the registry number for N-(2-Fluorobenzylidene)-4-methylbenzenesulfonamide, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(NE)-N-[(2-fluorophenyl)methylidene]-4-methylbenzenesulfonamide (CAS 341023-38-9) is a chemical compound with the molecular formula C14H12FNO2S and a molecular weight of 277.32 g/mol. IUPAC name: (NE)-N-[(2-fluorophenyl)methylidene]-4-methylbenzenesulfonamide. InChIKey: FGPVIQBJBXYBLL-MHWRWJLKSA-N.
| Molecular formula | C14H12FNO2S |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | (NE)-N-[(2-fluorophenyl)methylidene]-4-methylbenzenesulfonamide |
| InChIKey | FGPVIQBJBXYBLL-MHWRWJLKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/N=C/C2=CC=CC=C2F |
Computed by PubChem (NCBI)