Products 34105-81-2
CAS 34105-81-2 is the registry number for Methyl 3-Methyl-2-butenoate-D7. Offered by: TRC. Available pack sizes: 250mg.
Methyl 2,4,4,4-tetradeuterio-3-(trideuteriomethyl)but-2-enoate (CAS 34105-81-2) is a chemical compound with the molecular formula C6H10O2 and a molecular weight of 121.19 g/mol. IUPAC name: methyl 2,4,4,4-tetradeuterio-3-(trideuteriomethyl)but-2-enoate. InChIKey: FZIBCCGGICGWBP-UAVYNJCWSA-N.
| Molecular formula | C6H10O2 |
|---|---|
| Molecular weight | 121.19 g/mol |
| IUPAC name | methyl 2,4,4,4-tetradeuterio-3-(trideuteriomethyl)but-2-enoate |
| InChIKey | FZIBCCGGICGWBP-UAVYNJCWSA-N |
| SMILES | [2H]C(=C(C([2H])([2H])[2H])C([2H])([2H])[2H])C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3-Methyl-2-butenoate-D7