CAS 34121-17-0 is the registry number for 2-Amino-5-(aminosulfonyl)-4-chlorobenzamide. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-amino-4-chloro-5-sulfamoylbenzamide (CAS 34121-17-0) is a chemical compound with the molecular formula C7H8ClN3O3S and a molecular weight of 249.68 g/mol. IUPAC name: 2-amino-4-chloro-5-sulfamoylbenzamide. InChIKey: YZVLDYQGTHLMDZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O3S |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 2-amino-4-chloro-5-sulfamoylbenzamide |
| InChIKey | YZVLDYQGTHLMDZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)N)Cl)N)C(=O)N |
Computed by PubChem (NCBI)