CAS 3413-58-9 appears in our catalog under these names: Ethylhydrocupreine hydrochloride, 95%, Ethylhydrocupreine HCl, 99+%, Ethylhydrocupreine hydrochloride/ 99.27% (existing batch purity), Ethylhydrocupreine hydrochloride, Ethylhydrocupreine hydrochloride, 97% . Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 250mg, 10g, 5g, 1g, 5mg, 10mg, 25mg.
(R)-(6-ethoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride (CAS 3413-58-9) is a chemical compound with the molecular formula C21H29ClN2O2 and a molecular weight of 376.9 g/mol. IUPAC name: (R)-(6-ethoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride. InChIKey: QNRATNLHPGXHMA-XZHTYLCXSA-N.
| Molecular formula | C21H29ClN2O2 |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | (R)-(6-ethoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride |
| InChIKey | QNRATNLHPGXHMA-XZHTYLCXSA-N |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=C4C=C(C=CC4=NC=C3)OCC)O.Cl |
Computed by PubChem (NCBI)