CAS 3414-63-9 appears in our catalog under these names: (±)-Norepinephrine bitartrate, (±)–Norepinephrine bitartrate, Norepinephrine bitartrate salt/ 97.32% (existing batch purity), (+/-)-NOREPINEPHRINE (+)-BITARTRATE SALT, DL-Norepinephrine (tartrate), 95.04%. Offered by: Dr. Ehrenstorfer, GLPBio, TargetMol, Sigma-Aldrich, MedChemExpress. Available pack sizes: 50mg, 1g, 5g, 5mg, 10mg, 25mg, 100mg, 500mg.
4-(2-amino-1-hydroxyethyl)benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate (CAS 3414-63-9) is a chemical compound with the molecular formula C12H15NO9-2 and a molecular weight of 317.25 g/mol. IUPAC name: 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate. InChIKey: WNPNNLQNNJQYFA-LREBCSMRSA-L.
| Molecular formula | C12H15NO9-2 |
|---|---|
| Molecular weight | 317.25 g/mol |
| IUPAC name | 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | WNPNNLQNNJQYFA-LREBCSMRSA-L |
| SMILES | C1=CC(=C(C=C1C(CN)O)O)O.[C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O |
Computed by PubChem (NCBI)