CAS 34143-33-4 is the registry number for Nifuratel Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-(sulfanylmethyl)-1,3-oxazolidin-2-one (CAS 34143-33-4) is a chemical compound with the molecular formula C9H9N3O5S and a molecular weight of 271.25 g/mol. IUPAC name: 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-(sulfanylmethyl)-1,3-oxazolidin-2-one. InChIKey: BQABUJGRBBRMPS-XCVCLJGOSA-N.
| Molecular formula | C9H9N3O5S |
|---|---|
| Molecular weight | 271.25 g/mol |
| IUPAC name | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-(sulfanylmethyl)-1,3-oxazolidin-2-one |
| InChIKey | BQABUJGRBBRMPS-XCVCLJGOSA-N |
| SMILES | C1C(OC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-])CS |
Computed by PubChem (NCBI)