CAS 34143-74-3 appears in our catalog under these names: 1H,1H,2H,2H–Perfluorodecanethiol, 1H,1H,2H,2H-PERFLUORODECANETHIOL, 97%. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100g, 1g, 25g, 5g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol (CAS 34143-74-3) is a chemical compound with the molecular formula C10H5F17S and a molecular weight of 480.19 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol. InChIKey: URJIJZCEKHSLHA-UHFFFAOYSA-N.
| Molecular formula | C10H5F17S |
|---|---|
| Molecular weight | 480.19 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol |
| InChIKey | URJIJZCEKHSLHA-UHFFFAOYSA-N |
| SMILES | C(CS)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)