CAS 34144-82-6 is the registry number for Suxemerid (disulfate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid (CAS 34144-82-6) is a chemical compound with the molecular formula C24H48N2O12S2 and a molecular weight of 620.8 g/mol. IUPAC name: bis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid. InChIKey: VGVAGSHQBXDIOJ-UHFFFAOYSA-N.
| Molecular formula | C24H48N2O12S2 |
|---|---|
| Molecular weight | 620.8 g/mol |
| IUPAC name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid |
| InChIKey | VGVAGSHQBXDIOJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1C)(C)C)OC(=O)CCC(=O)OC2CC(N(C(C2)(C)C)C)(C)C)C.OS(=O)(=O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)