Products 34144-82-6

CAS 34144-82-6 is the registry number for Suxemerid (disulfate). Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid (CAS 34144-82-6) is a chemical compound with the molecular formula C24H48N2O12S2 and a molecular weight of 620.8 g/mol. IUPAC name: bis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid. InChIKey: VGVAGSHQBXDIOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H48N2O12S2
Molecular weight620.8 g/mol
IUPAC namebis(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate;sulfuric acid
InChIKeyVGVAGSHQBXDIOJ-UHFFFAOYSA-N
SMILESCC1(CC(CC(N1C)(C)C)OC(=O)CCC(=O)OC2CC(N(C(C2)(C)C)C)(C)C)C.OS(=O)(=O)O.OS(=O)(=O)O

Computed by PubChem (NCBI)