CAS 34154-81-9 is the registry number for rac-syn N,N-Diethyl Norephedrine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol (CAS 34154-81-9) is a chemical compound with the molecular formula C13H21NO and a molecular weight of 207.31 g/mol. IUPAC name: (1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol. InChIKey: JMFCQRKXGIHOAN-WCQYABFASA-N.
| Molecular formula | C13H21NO |
|---|---|
| Molecular weight | 207.31 g/mol |
| IUPAC name | (1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol |
| InChIKey | JMFCQRKXGIHOAN-WCQYABFASA-N |
| SMILES | CCN(CC)[C@@H](C)[C@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)