CAS 34169-70-5 is the registry number for Pterosin D. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 10mg, 50mg, Get quote.
(3R)-3-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one (CAS 34169-70-5) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (3R)-3-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one. InChIKey: FITSCHPIOGIYJY-CYBMUJFWSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (3R)-3-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one |
| InChIKey | FITSCHPIOGIYJY-CYBMUJFWSA-N |
| SMILES | CC1=CC2=C(C(=C1CCO)C)C(=O)C([C@@H]2O)(C)C |
Computed by PubChem (NCBI)