CAS 3419-34-9 appears in our catalog under these names: Dimethoate Impurity 5, Potassium Diisopropylxanthate. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 2,5g, 5g.
Potassium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane (CAS 3419-34-9) is a chemical compound with the molecular formula C6H14KO2PS2 and a molecular weight of 252.4 g/mol. IUPAC name: potassium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane. InChIKey: PJJZTOTXLDXTEL-UHFFFAOYSA-M.
| Molecular formula | C6H14KO2PS2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | potassium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane |
| InChIKey | PJJZTOTXLDXTEL-UHFFFAOYSA-M |
| SMILES | CC(C)OP(=S)(OC(C)C)[S-].[K+] |
Computed by PubChem (NCBI)