CAS 34192-19-3 is the registry number for 2,4-Dimethyl-5,6,7,8-tetrahydroquinolin-5-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,4-dimethyl-7,8-dihydro-6H-quinolin-5-one (CAS 34192-19-3) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2,4-dimethyl-7,8-dihydro-6H-quinolin-5-one. InChIKey: DASHRGLAWNGDDD-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2,4-dimethyl-7,8-dihydro-6H-quinolin-5-one |
| InChIKey | DASHRGLAWNGDDD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=O)CCC2)C |
Computed by PubChem (NCBI)