CAS 34199-07-0 appears in our catalog under these names: (H-Cys-pNA)2, (H–Cys–pNA)₂, (H-Cys-pNA)2 (Disulfide bond). Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2-amino-3-[[2-amino-3-(4-nitroanilino)-3-oxopropyl]disulfanyl]-N-(4-nitrophenyl)propanamide (CAS 34199-07-0) is a chemical compound with the molecular formula C18H20N6O6S2 and a molecular weight of 480.5 g/mol. IUPAC name: 2-amino-3-[[2-amino-3-(4-nitroanilino)-3-oxopropyl]disulfanyl]-N-(4-nitrophenyl)propanamide. InChIKey: UDNQCHDHUMEZRM-UHFFFAOYSA-N.
| Molecular formula | C18H20N6O6S2 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | 2-amino-3-[[2-amino-3-(4-nitroanilino)-3-oxopropyl]disulfanyl]-N-(4-nitrophenyl)propanamide |
| InChIKey | UDNQCHDHUMEZRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(CSSCC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)