CAS 342005-82-7 appears in our catalog under these names: Nebentan potassium, 98%, Nebentan potassium, Nebentan potassium/ 98.92% (existing batch purity), Nebentan (potassium), Nebentan (potassium), 99.53%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 1mg, 2mg, 50mg.
Potassium [6-methoxy-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-[(E)-2-phenylethenyl]sulfonylazanide (CAS 342005-82-7) is a chemical compound with the molecular formula C24H20KN5O5S and a molecular weight of 529.6 g/mol. IUPAC name: potassium [6-methoxy-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-[(E)-2-phenylethenyl]sulfonylazanide. InChIKey: WOPWEXSDEXIRNG-ZUQRMPMESA-N.
| Molecular formula | C24H20KN5O5S |
|---|---|
| Molecular weight | 529.6 g/mol |
| IUPAC name | potassium [6-methoxy-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-[(E)-2-phenylethenyl]sulfonylazanide |
| InChIKey | WOPWEXSDEXIRNG-ZUQRMPMESA-N |
| SMILES | COC1=CC=CC=C1OC2=C(N=C(N=C2OC)C3=NC=CC=N3)[N-]S(=O)(=O)/C=C/C4=CC=CC=C4.[K+] |
Computed by PubChem (NCBI)