CAS 3423-23-2 is the registry number for Ipratropium Bromide Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-ol (CAS 3423-23-2) is a chemical compound with the molecular formula C10H19NO and a molecular weight of 169.26 g/mol. IUPAC name: (1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-ol. InChIKey: YYDQYSQZIUSKFN-ULKQDVFKSA-N.
| Molecular formula | C10H19NO |
|---|---|
| Molecular weight | 169.26 g/mol |
| IUPAC name | (1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-ol |
| InChIKey | YYDQYSQZIUSKFN-ULKQDVFKSA-N |
| SMILES | CC(C)N1[C@@H]2CC[C@H]1CC(C2)O |
Computed by PubChem (NCBI)