CAS 34241-86-6 is the registry number for 1,3-Bis((phenyl)-ethenyl)-benzene. Offered by: Biosynth. Available pack sizes: 1g, 5g, 10g.
1,3-bis(1-phenylethenyl)benzene (CAS 34241-86-6) is a chemical compound with the molecular formula C22H18 and a molecular weight of 282.4 g/mol. IUPAC name: 1,3-bis(1-phenylethenyl)benzene. InChIKey: YVWBWDZQFGXBOT-UHFFFAOYSA-N.
| Molecular formula | C22H18 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 1,3-bis(1-phenylethenyl)benzene |
| InChIKey | YVWBWDZQFGXBOT-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=CC=C1)C2=CC(=CC=C2)C(=C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)