CAS 342594-95-0 is the registry number for KLK7 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]oxazin-4-one (CAS 342594-95-0) is a chemical compound with the molecular formula C16H12FNO2S and a molecular weight of 301.3 g/mol. IUPAC name: 2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]oxazin-4-one. InChIKey: HDQZJWISFBAGPN-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2S |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]oxazin-4-one |
| InChIKey | HDQZJWISFBAGPN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(OC3=O)C4=CC=CC=C4F |
Computed by PubChem (NCBI)