CAS 3426-65-1 is the registry number for N-(Pentachlorophenyl)ethane-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N'-(2,3,4,5,6-pentachlorophenyl)ethane-1,2-diamine (CAS 3426-65-1) is a chemical compound with the molecular formula C8H7Cl5N2 and a molecular weight of 308.4 g/mol. IUPAC name: N'-(2,3,4,5,6-pentachlorophenyl)ethane-1,2-diamine. InChIKey: NKIPRDISYSAKLQ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl5N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | N'-(2,3,4,5,6-pentachlorophenyl)ethane-1,2-diamine |
| InChIKey | NKIPRDISYSAKLQ-UHFFFAOYSA-N |
| SMILES | C(CNC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)N |
Computed by PubChem (NCBI)