CAS 342611-05-6 appears in our catalog under these names: 2-Phenylethyl-d9-amine, 2-Phenylethyl-d9-amine, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g.
1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanamine (CAS 342611-05-6) is a chemical compound with the molecular formula C8H11N and a molecular weight of 130.23 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanamine. InChIKey: BHHGXPLMPWCGHP-NVLGFDPUSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 130.23 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanamine |
| InChIKey | BHHGXPLMPWCGHP-NVLGFDPUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])N)[2H])[2H] |
Computed by PubChem (NCBI)