CAS 342652-67-9 appears in our catalog under these names: Mrk-016, 95%, MRK 016, MRK-016 99%, Mrk-016, 99%, 99%, MRK-016, 99.71%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 5mg, 100mg, 1mg, 250mg, 25 mg.
3-[3-tert-butyl-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazin-7-yl]-5-methyl-1,2-oxazole (CAS 342652-67-9) is a chemical compound with the molecular formula C17H20N8O2 and a molecular weight of 368.4 g/mol. IUPAC name: 3-[3-tert-butyl-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazin-7-yl]-5-methyl-1,2-oxazole. InChIKey: QYSYOGCIDRANAR-UHFFFAOYSA-N.
| Molecular formula | C17H20N8O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3-[3-tert-butyl-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazin-7-yl]-5-methyl-1,2-oxazole |
| InChIKey | QYSYOGCIDRANAR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)C2=NN=CC3=C(C(=NN32)OCC4=NC=NN4C)C(C)(C)C |
Computed by PubChem (NCBI)