CAS 342795-11-3 is the registry number for Namoline. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, Get quote.
3-chloro-6-nitro-2-(trifluoromethyl)chromen-4-one (CAS 342795-11-3) is a chemical compound with the molecular formula C10H3ClF3NO4 and a molecular weight of 293.58 g/mol. IUPAC name: 3-chloro-6-nitro-2-(trifluoromethyl)chromen-4-one. InChIKey: DYEGRZKBJMKSKD-UHFFFAOYSA-N.
| Molecular formula | C10H3ClF3NO4 |
|---|---|
| Molecular weight | 293.58 g/mol |
| IUPAC name | 3-chloro-6-nitro-2-(trifluoromethyl)chromen-4-one |
| InChIKey | DYEGRZKBJMKSKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C(=C(O2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)