CAS 342808-40-6 appears in our catalog under these names: 3,5-Bis((2-fluorophenyl)methylene)-4-piperidinone, EF24/ 98.47% (existing batch purity), EF24, EF24 99%, EF-24. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one (CAS 342808-40-6) is a chemical compound with the molecular formula C19H15F2NO and a molecular weight of 311.3 g/mol. IUPAC name: (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one. InChIKey: NIVYQYSNRUIFIF-KAVGSWPWSA-N.
| Molecular formula | C19H15F2NO |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one |
| InChIKey | NIVYQYSNRUIFIF-KAVGSWPWSA-N |
| SMILES | C\1NC/C(=C\C2=CC=CC=C2F)/C(=O)/C1=C/C3=CC=CC=C3F |
Computed by PubChem (NCBI)