CAS 342888-76-0 appears in our catalog under these names: 4'-(Naphthalen-1-yl)-2,2':6',2''-terpyridine, 95%, 95%, 4'-(Naphthalen-1-yl)-2,2':6',2''-terpyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-naphthalen-1-yl-2,6-dipyridin-2-ylpyridine (CAS 342888-76-0) is a chemical compound with the molecular formula C25H17N3 and a molecular weight of 359.4 g/mol. IUPAC name: 4-naphthalen-1-yl-2,6-dipyridin-2-ylpyridine. InChIKey: AHJBCFSNCQTVBR-UHFFFAOYSA-N.
| Molecular formula | C25H17N3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-naphthalen-1-yl-2,6-dipyridin-2-ylpyridine |
| InChIKey | AHJBCFSNCQTVBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=NC(=C3)C4=CC=CC=N4)C5=CC=CC=N5 |
Computed by PubChem (NCBI)