CAS 343-01-1 appears in our catalog under these names: 2-Fluoro-9-fluorenone, 98%, 2-Fluoro-9H-fluoren-9-one, 98%, 2-Fluoro-9-fluorenone, 98%, 98%, 2-Fluorofluoren-9-one, 98.03%. Offered by: Combi-blocks, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 5 g, 100 mg, 250 mg, 1 g.
2-fluorofluoren-9-one (CAS 343-01-1) is a chemical compound with the molecular formula C13H7FO and a molecular weight of 198.19 g/mol. IUPAC name: 2-fluorofluoren-9-one. InChIKey: CNCFLCLXJBPMIR-UHFFFAOYSA-N.
| Molecular formula | C13H7FO |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 2-fluorofluoren-9-one |
| InChIKey | CNCFLCLXJBPMIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)F |
Computed by PubChem (NCBI)