CAS 34316-54-6 appears in our catalog under these names: 2,2'-Dibromobianthrone, 95%, 2,2'-Dibromobianthrone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
3-bromo-10-(2-bromo-10-oxoanthracen-9-ylidene)anthracen-9-one (CAS 34316-54-6) is a chemical compound with the molecular formula C28H14Br2O2 and a molecular weight of 542.2 g/mol. IUPAC name: 3-bromo-10-(2-bromo-10-oxoanthracen-9-ylidene)anthracen-9-one. InChIKey: RDWYKRDNFXGTBO-UHFFFAOYSA-N.
| Molecular formula | C28H14Br2O2 |
|---|---|
| Molecular weight | 542.2 g/mol |
| IUPAC name | 3-bromo-10-(2-bromo-10-oxoanthracen-9-ylidene)anthracen-9-one |
| InChIKey | RDWYKRDNFXGTBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C4=CC=CC=C4C(=O)C5=C3C=C(C=C5)Br)C6=C(C2=O)C=CC(=C6)Br |
Computed by PubChem (NCBI)