Products 343338-31-8
CAS 343338-31-8 appears in our catalog under these names: (2E)-3-(Phenyl-2,3,4,5,6-d5)-2-propenoic-2,3-d2 Acid, >95% (HPLC), trans-Cinnamic-d7 Acid, 98 atom % D, min 98% Chemical Purity, trans–Cinnamic acid–d7, trans-Cinnamic acid-d7, 99.98%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 1g, 0,5g, 10mg, 100mg, 25mg, 5mg, 5 mg.
(E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid (CAS 343338-31-8) is a chemical compound with the molecular formula C9H8O2 and a molecular weight of 155.20 g/mol. IUPAC name: (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid. InChIKey: WBYWAXJHAXSJNI-UJMUNGNDSA-N.
| Molecular formula | C9H8O2 |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid |
| InChIKey | WBYWAXJHAXSJNI-UJMUNGNDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C(\[2H])/C(=O)O)/[2H])[2H])[2H] |
Computed by PubChem (NCBI)