Products 34334-71-9
CAS 34334-71-9 appears in our catalog under these names: Ethylene Diamine Dihydrochloride-d4, >95% (HPLC), Ethylene-d4-diamine 2HCl, 98 atom % D, min 98% Chemical Purity, Ethylene diamine dihydrochloride-d4, Ethane-1,2-diamine-d4 (dihydrochloride), 99.9%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 500mg, 50mg, 1g, 0,5g, 2g, 500 mg, 50 mg, 100 mg.
1,1,2,2-tetradeuterioethane-1,2-diamine;dihydrochloride (CAS 34334-71-9) is a chemical compound with the molecular formula C2H10Cl2N2 and a molecular weight of 137.04 g/mol. IUPAC name: 1,1,2,2-tetradeuterioethane-1,2-diamine;dihydrochloride. InChIKey: OHHBFEVZJLBKEH-RIZDZYNXSA-N.
| Molecular formula | C2H10Cl2N2 |
|---|---|
| Molecular weight | 137.04 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterioethane-1,2-diamine;dihydrochloride |
| InChIKey | OHHBFEVZJLBKEH-RIZDZYNXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Ethylene-d4-diamine dihydrochloride, Ethylene Diamine Dihydrochloride-d4, 1,1,2,2-tetradeuterioethane-1,2-diamine;dihydrochloride, 1,1,2,2-tetradeuterioethane-1,2-diamine dihydrochloride, orb3027400, (2H?)ethane-1,2-diamine dihydrochloride, 1,1,2,2-Tetradeuterioethane-1,2-diamine diHCl, 1,2-Ethane-1,1,2,2-d4-diamine dihydrochloride, Ethylene-d4-diamine dihydrochloride, 98 atom % D