CAS 34335-10-9 appears in our catalog under these names: Zinc(II) phenylphosphonate, 95%, Zinc(II) phenylphosphonate 98+%, Zinc(II) phenylphosphonate, 98%, 98%, Zinc(II) phenylphosphonate, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 25g.
Zinc dioxido-oxo-phenyl-lambda5-phosphane (CAS 34335-10-9) is a chemical compound with the molecular formula C6H5O3PZn and a molecular weight of 221.5 g/mol. IUPAC name: zinc dioxido-oxo-phenyl-lambda5-phosphane. InChIKey: VYXPIEPOZNGSJX-UHFFFAOYSA-L.
| Molecular formula | C6H5O3PZn |
|---|---|
| Molecular weight | 221.5 g/mol |
| IUPAC name | zinc dioxido-oxo-phenyl-lambda5-phosphane |
| InChIKey | VYXPIEPOZNGSJX-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(=O)([O-])[O-].[Zn+2] |
Computed by PubChem (NCBI)