CAS 34353-37-2 is the registry number for Leucothionin. Offered by: TRC, Biosynth. Available pack sizes: 250mg.
7-N,7-N-diethyl-3-N,3-N-dimethyl-10H-phenothiazine-3,7-diamine (CAS 34353-37-2) is a chemical compound with the molecular formula C18H23N3S and a molecular weight of 313.5 g/mol. IUPAC name: 7-N,7-N-diethyl-3-N,3-N-dimethyl-10H-phenothiazine-3,7-diamine. InChIKey: OKQDKRPSSMTACZ-UHFFFAOYSA-N.
| Molecular formula | C18H23N3S |
|---|---|
| Molecular weight | 313.5 g/mol |
| IUPAC name | 7-N,7-N-diethyl-3-N,3-N-dimethyl-10H-phenothiazine-3,7-diamine |
| InChIKey | OKQDKRPSSMTACZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)NC3=C(S2)C=C(C=C3)N(C)C |
Computed by PubChem (NCBI)