CAS 343564-38-5 appears in our catalog under these names: 4-Bromo-O-(t-butyldimethylsilyl)-2,6-dichlorophenol, 98%, (4-Bromo-2,6-dichlorophenoxy)(tert-butyl)dimethylsilane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
(4-bromo-2,6-dichlorophenoxy)-tert-butyl-dimethylsilane (CAS 343564-38-5) is a chemical compound with the molecular formula C12H17BrCl2OSi and a molecular weight of 356.15 g/mol. IUPAC name: (4-bromo-2,6-dichlorophenoxy)-tert-butyl-dimethylsilane. InChIKey: KNKUFFVFNKGIDT-UHFFFAOYSA-N.
| Molecular formula | C12H17BrCl2OSi |
|---|---|
| Molecular weight | 356.15 g/mol |
| IUPAC name | (4-bromo-2,6-dichlorophenoxy)-tert-butyl-dimethylsilane |
| InChIKey | KNKUFFVFNKGIDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)