CAS 343582-05-8 is the registry number for tert-Butyl 3-oxo-4-((2,2,2-trifluoroacetamido)methyl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 3-oxo-4-[[(2,2,2-trifluoroacetyl)amino]methyl]pyrrolidine-1-carboxylate (CAS 343582-05-8) is a chemical compound with the molecular formula C12H17F3N2O4 and a molecular weight of 310.27 g/mol. IUPAC name: tert-butyl 3-oxo-4-[[(2,2,2-trifluoroacetyl)amino]methyl]pyrrolidine-1-carboxylate. InChIKey: DYDNYIBUMYHKFO-UHFFFAOYSA-N.
| Molecular formula | C12H17F3N2O4 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | tert-butyl 3-oxo-4-[[(2,2,2-trifluoroacetyl)amino]methyl]pyrrolidine-1-carboxylate |
| InChIKey | DYDNYIBUMYHKFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)C1)CNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)