CAS 343630-41-1 appears in our catalog under these names: NS3623, NS 3623, NS3623/ 98.1% (existing batch purity), NS 3623, NS3623 99+%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 1mg, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (CAS 343630-41-1) is a chemical compound with the molecular formula C15H10BrF3N6O and a molecular weight of 427.18 g/mol. IUPAC name: 1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: JXPULDIATMTIIN-UHFFFAOYSA-N.
| Molecular formula | C15H10BrF3N6O |
|---|---|
| Molecular weight | 427.18 g/mol |
| IUPAC name | 1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | JXPULDIATMTIIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=C(C=C(C=C2)Br)C3=NNN=N3)C(F)(F)F |
Computed by PubChem (NCBI)