CAS 34364-42-6 is the registry number for 4-Cumylphenyl diphenyl phosphate. Offered by: TRC. Available pack sizes: 1g.
Diphenyl (3-phenyl-5-propan-2-ylphenyl) phosphate (CAS 34364-42-6) is a chemical compound with the molecular formula C27H25O4P and a molecular weight of 444.5 g/mol. IUPAC name: diphenyl (3-phenyl-5-propan-2-ylphenyl) phosphate. InChIKey: KMLCDKUGVGTGBJ-UHFFFAOYSA-N.
| Molecular formula | C27H25O4P |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | diphenyl (3-phenyl-5-propan-2-ylphenyl) phosphate |
| InChIKey | KMLCDKUGVGTGBJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C2=CC=CC=C2)OP(=O)(OC3=CC=CC=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)