Products 34393-22-1
CAS 34393-22-1 is the registry number for N-(1-Deoxy-D-fructos-1-yl)-L-tyrosine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 2,5mg.
(2S)-3-(4-hydroxyphenyl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid (CAS 34393-22-1) is a chemical compound with the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid. InChIKey: WWTFANNQTZSANT-IGHBBLSQSA-N.
| Molecular formula | C15H21NO8 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid |
| InChIKey | WWTFANNQTZSANT-IGHBBLSQSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)