CAS 343942-02-9 appears in our catalog under these names: 4’-Bromoacetophenone-d4, 4'-Bromoacetophenone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 25 mg, 100 mg, 10 mg, 50 mg.
1-(4-bromo-2,3,5,6-tetradeuteriophenyl)ethanone (CAS 343942-02-9) is a chemical compound with the molecular formula C8H7BrO and a molecular weight of 203.07 g/mol. IUPAC name: 1-(4-bromo-2,3,5,6-tetradeuteriophenyl)ethanone. InChIKey: WYECURVXVYPVAT-QFFDRWTDSA-N.
| Molecular formula | C8H7BrO |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 1-(4-bromo-2,3,5,6-tetradeuteriophenyl)ethanone |
| InChIKey | WYECURVXVYPVAT-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)