CAS 343962-67-4 is the registry number for (S)-Isopropyl-2-aminopropanoate-d7 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl (2S)-2-aminopropanoate;hydrochloride (CAS 343962-67-4) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 174.68 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl (2S)-2-aminopropanoate;hydrochloride. InChIKey: YAQKNCSWDMGPOY-SAADNGMHSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 174.68 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | YAQKNCSWDMGPOY-SAADNGMHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC(=O)[C@H](C)N.Cl |
Computed by PubChem (NCBI)