CAS 344-09-2 is the registry number for 3-Chloro-2,4,6-trifluoroaniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-2,4,6-trifluoroaniline (CAS 344-09-2) is a chemical compound with the molecular formula C6H3ClF3N and a molecular weight of 181.54 g/mol. IUPAC name: 3-chloro-2,4,6-trifluoroaniline. InChIKey: IZVNZHYBSJJGAI-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3N |
|---|---|
| Molecular weight | 181.54 g/mol |
| IUPAC name | 3-chloro-2,4,6-trifluoroaniline |
| InChIKey | IZVNZHYBSJJGAI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)N)F |
Computed by PubChem (NCBI)