CAS 344-10-5 is the registry number for 6-Amino-2,4-dibromo-3-fluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-amino-2,4-dibromo-3-fluorophenol (CAS 344-10-5) is a chemical compound with the molecular formula C6H4Br2FNO and a molecular weight of 284.91 g/mol. IUPAC name: 6-amino-2,4-dibromo-3-fluorophenol. InChIKey: IDMAAPXJSAAGAQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2FNO |
|---|---|
| Molecular weight | 284.91 g/mol |
| IUPAC name | 6-amino-2,4-dibromo-3-fluorophenol |
| InChIKey | IDMAAPXJSAAGAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Br)O)N |
Computed by PubChem (NCBI)