CAS 344299-49-6 appears in our catalog under these names: Nt-Methyl-d3-histamine Dihydrochloride, >95% (HPLC), Nt-Methyl-d3-histamine 2HCl, >95% (HPLC), 1-Methyl-d3-histamine 2HCl, 98 atom % D, min 98% Chemical Purity, 1–Methylhistamine–d3 dihydrochloride, 1-Methylhistamine-d3 (dihydrochloride), 99.91%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
2-[1-(trideuteriomethyl)imidazol-4-yl]ethanamine;dihydrochloride (CAS 344299-49-6) is a chemical compound with the molecular formula C6H13Cl2N3 and a molecular weight of 201.11 g/mol. IUPAC name: 2-[1-(trideuteriomethyl)imidazol-4-yl]ethanamine;dihydrochloride. InChIKey: AGXVEALMQHTMSW-GXXYEPOPSA-N.
| Molecular formula | C6H13Cl2N3 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 2-[1-(trideuteriomethyl)imidazol-4-yl]ethanamine;dihydrochloride |
| InChIKey | AGXVEALMQHTMSW-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(N=C1)CCN.Cl.Cl |
Computed by PubChem (NCBI)