CAS 34433-31-3 appears in our catalog under these names: Asoxime chloride, 95%, Asoxime Chloride, Asoxime Chloride, >95% (HPLC), Asoxime dichloride/ 99.86% (existing batch purity), Asoxime (chloride). Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 250mg, on request, 50mg, 5mg, 10mg, 25mg, 0,25g.
1-[[2-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride (CAS 34433-31-3) is a chemical compound with the molecular formula C14H16Cl2N4O3 and a molecular weight of 359.2 g/mol. IUPAC name: 1-[[2-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride. InChIKey: QELSIJXWEROXOE-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N4O3 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 1-[[2-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride |
| InChIKey | QELSIJXWEROXOE-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C(=C1)/C=N/O)COC[N+]2=CC=C(C=C2)C(=O)N.[Cl-].[Cl-] |
Computed by PubChem (NCBI)