Products 344413-84-9

CAS 344413-84-9 is the registry number for ((S)-2-Fluoro-3-hydroxy-propyl)-carbamic acid tert-butyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Tert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate (CAS 344413-84-9) is a chemical compound with the molecular formula C8H16FNO3 and a molecular weight of 193.22 g/mol. IUPAC name: tert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate. InChIKey: MXXNEFMIRPHICR-LURJTMIESA-N.

Identity
Molecular formulaC8H16FNO3
Molecular weight193.22 g/mol
IUPAC nametert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate
InChIKeyMXXNEFMIRPHICR-LURJTMIESA-N
SMILESCC(C)(C)OC(=O)NC[C@@H](CO)F

Computed by PubChem (NCBI)