CAS 344413-84-9 is the registry number for ((S)-2-Fluoro-3-hydroxy-propyl)-carbamic acid tert-butyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate (CAS 344413-84-9) is a chemical compound with the molecular formula C8H16FNO3 and a molecular weight of 193.22 g/mol. IUPAC name: tert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate. InChIKey: MXXNEFMIRPHICR-LURJTMIESA-N.
| Molecular formula | C8H16FNO3 |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-fluoro-3-hydroxypropyl]carbamate |
| InChIKey | MXXNEFMIRPHICR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CO)F |
Computed by PubChem (NCBI)